About phenacyl morpholine-4-carboxylate
phenacyl morpholine-4-carboxylate (PubChem CID 138963634) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is phenacyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | phenacyl morpholine-4-carboxylate |
| PubChem CID | 138963634 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | phenacyl morpholine-4-carboxylate |
| SMILES | O=C(COC(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C13H15NO4/c15-12(11-4-2-1-3-5-11)10-18-13(16)14-6-8-17-9-7-14/h1-5H,6-10H2 |
| InChIKey | YRRUHCASUIWAKR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl morpholine-4-carboxylate?
The IUPAC name of phenacyl morpholine-4-carboxylate (CID 138963634) is phenacyl morpholine-4-carboxylate.
What is the SMILES notation for phenacyl morpholine-4-carboxylate?
The canonical SMILES for phenacyl morpholine-4-carboxylate is O=C(COC(=O)N1CCOCC1)c1ccccc1.
What is the InChIKey of phenacyl morpholine-4-carboxylate?
The InChIKey is YRRUHCASUIWAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c15-12(11-4-2-1-3-5-11)10-18-13(16)14-6-8-17-9-7-14/h1-5H,6-10H2.
What are the key properties of phenacyl morpholine-4-carboxylate?
phenacyl morpholine-4-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl morpholine-4-carboxylate is sourced from PubChem (CID 138963634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).