C30H37N3O11 — CID 138963998
[(3R,6R)-3,4,5-triacetyloxy-6-[[1-[(1R)-2-(4-methoxyphenyl)cyclohex-2-en-1-yl]triazol-4-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 138963998) has the molecular formula C30H37N3O11 and a molecular weight of 615.64 g/mol. Its IUPAC name is [(3R,6R)-3,4,5-triacetyloxy-6-[[1-[(1R)-2-(4-methoxyphenyl)cyclohex-2-en-1-yl]triazol-4-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,4,5-triacetyloxy-6-[[1-[(1R)-2-(4-methoxyphenyl)cyclohex-2-en-1-yl]triazol-4-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138963998 |
| Molecular Formula | C30H37N3O11 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | [(3R,6R)-3,4,5-triacetyloxy-6-[[1-[(1R)-2-(4-methoxyphenyl)cyclohex-2-en-1-yl]triazol-4-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(C2=CCCC[C@H]2n2cc(CO[C@@H]3OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C3OC(C)=O)nn2)cc1 |
| InChI | InChI=1S/C30H37N3O11/c1-17(34)39-16-26-27(41-18(2)35)28(42-19(3)36)29(43-20(4)37)30(44-26)40-15-22-14-33(32-31-22)25-9-7-6-8-24(25)21-10-12-23(38-5)13-11-21/h8,10-14,25-30H,6-7,9,15-16H2,1-5H3/t25-,26?,27-,28?,29?,30-/m1/s1 |
| InChIKey | PGVCCJRDCCNFNT-CFKVEPSDSA-N |
| XLogP | 2.69 |
| TPSA | 163.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|