C20H22N2O6S — CID 138966156
(1S,3S,8R,10R,13S)-16-(4-nitrophenyl)sulfonyl-9-oxa-16-azatetracyclo[11.2.1.01,10.03,8]hexadec-14-en-11-one (PubChem CID 138966156) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (1S,3S,8R,10R,13S)-16-(4-nitrophenyl)sulfonyl-9-oxa-16-azatetracyclo[11.2.1.01,10.03,8]hexadec-14-en-11-one.
| Compound Name | (1S,3S,8R,10R,13S)-16-(4-nitrophenyl)sulfonyl-9-oxa-16-azatetracyclo[11.2.1.01,10.03,8]hexadec-14-en-11-one |
|---|---|
| PubChem CID | 138966156 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (1S,3S,8R,10R,13S)-16-(4-nitrophenyl)sulfonyl-9-oxa-16-azatetracyclo[11.2.1.01,10.03,8]hexadec-14-en-11-one |
| SMILES | O=C1C[C@H]2C=C[C@]3(C[C@@H]4CCCC[C@H]4O[C@@H]13)N2S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O6S/c23-17-11-15-9-10-20(12-13-3-1-2-4-18(13)28-19(17)20)21(15)29(26,27)16-7-5-14(6-8-16)22(24)25/h5-10,13,15,18-19H,1-4,11-12H2/t13-,15+,18+,19-,20+/m0/s1 |
| InChIKey | ASCJSKBVRNWCAT-AYHUEBJRSA-N |
| XLogP | 2.58 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|