C15H14N2O6S — CID 138966159
(1S,5R,8S)-11-(4-nitrophenyl)sulfonyl-4-oxa-11-azatricyclo[6.2.1.01,5]undec-9-en-6-one (PubChem CID 138966159) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is (1S,5R,8S)-11-(4-nitrophenyl)sulfonyl-4-oxa-11-azatricyclo[6.2.1.01,5]undec-9-en-6-one.
| Compound Name | (1S,5R,8S)-11-(4-nitrophenyl)sulfonyl-4-oxa-11-azatricyclo[6.2.1.01,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 138966159 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1S,5R,8S)-11-(4-nitrophenyl)sulfonyl-4-oxa-11-azatricyclo[6.2.1.01,5]undec-9-en-6-one |
| SMILES | O=C1C[C@H]2C=C[C@]3(CCO[C@@H]13)N2S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N2O6S/c18-13-9-11-5-6-15(7-8-23-14(13)15)16(11)24(21,22)12-3-1-10(2-4-12)17(19)20/h1-6,11,14H,7-9H2/t11-,14+,15-/m1/s1 |
| InChIKey | BWEQEMLSGIHTIG-BYCMXARLSA-N |
| XLogP | 1.02 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|