C21H22N2O5 — CID 138966938
[(1R,10S,13R,14S,16S)-13-formyl-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate (PubChem CID 138966938) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [(1R,10S,13R,14S,16S)-13-formyl-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate.
| Compound Name | [(1R,10S,13R,14S,16S)-13-formyl-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate |
|---|---|
| PubChem CID | 138966938 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(1R,10S,13R,14S,16S)-13-formyl-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate |
| SMILES | CC(=O)OC1C2C3C[C@H]4C5=[N+]([O-])c6ccccc6[C@]51C[C@@H]2[N+]4([O-])[C@@H](C)[C@@H]3C=O |
| InChI | InChI=1S/C21H22N2O5/c1-10-13(9-24)12-7-16-19-21(14-5-3-4-6-15(14)22(19)26)8-17(23(10,16)27)18(12)20(21)28-11(2)25/h3-6,9-10,12-13,16-18,20H,7-8H2,1-2H3/t10-,12?,13-,16-,17-,18?,20?,21+,23?/m0/s1 |
| InChIKey | JFTABPCETWVXLD-DUIFPFAGSA-N |
| XLogP | 1.77 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|