C31H41BN4O6 — CID 138968681
tert-butyl 4-[9-methylidene-3,5-dioxo-4-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-10-en-8-yl]piperidine-1-carboxylate (PubChem CID 138968681) has the molecular formula C31H41BN4O6 and a molecular weight of 576.50 g/mol. Its IUPAC name is tert-butyl 4-[9-methylidene-3,5-dioxo-4-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-10-en-8-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[9-methylidene-3,5-dioxo-4-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-10-en-8-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138968681 |
| Molecular Formula | C31H41BN4O6 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | tert-butyl 4-[9-methylidene-3,5-dioxo-4-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-10-en-8-yl]piperidine-1-carboxylate |
| SMILES | C=C1C2C=CC(n3c(=O)n(-c4ccccc4)c(=O)n32)C1(B1OC(C)(C)C(C)(C)O1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H41BN4O6/c1-20-23-14-15-24(36-26(38)34(25(37)35(23)36)22-12-10-9-11-13-22)31(20,32-41-29(5,6)30(7,8)42-32)21-16-18-33(19-17-21)27(39)40-28(2,3)4/h9-15,21,23-24H,1,16-19H2,2-8H3 |
| InChIKey | IZOOYWXUDXBZCF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|