C23H33BFN3O4 — CID 178043187
tert-butyl (3S,4R)-3-fluoro-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]piperidine-1-carboxylate (PubChem CID 178043187) has the molecular formula C23H33BFN3O4 and a molecular weight of 445.34 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-fluoro-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-fluoro-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178043187 |
| Molecular Formula | C23H33BFN3O4 |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | tert-butyl (3S,4R)-3-fluoro-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](n2nc(B3OC(C)(C)C(C)(C)O3)c3ccccc32)[C@@H](F)C1 |
| InChI | InChI=1S/C23H33BFN3O4/c1-21(2,3)30-20(29)27-13-12-18(16(25)14-27)28-17-11-9-8-10-15(17)19(26-28)24-31-22(4,5)23(6,7)32-24/h8-11,16,18H,12-14H2,1-7H3/t16-,18+/m0/s1 |
| InChIKey | CLAJOGUAGDTIGK-FUHWJXTLSA-N |
| XLogP | 3.86 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|