C26H23NO4 — CID 138968830
(2S)-2-(1,3-dioxo-4,7-diphenylisoindol-2-yl)-3,3-dimethylbutanoic acid (PubChem CID 138968830) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxo-4,7-diphenylisoindol-2-yl)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(1,3-dioxo-4,7-diphenylisoindol-2-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 138968830 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2S)-2-(1,3-dioxo-4,7-diphenylisoindol-2-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N1C(=O)c2c(-c3ccccc3)ccc(-c3ccccc3)c2C1=O |
| InChI | InChI=1S/C26H23NO4/c1-26(2,3)22(25(30)31)27-23(28)20-18(16-10-6-4-7-11-16)14-15-19(21(20)24(27)29)17-12-8-5-9-13-17/h4-15,22H,1-3H3,(H,30,31)/t22-/m1/s1 |
| InChIKey | QURLJGJBKPXJDH-JOCHJYFZSA-N |
| XLogP | 5.12 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|