C30H23BiF6N2O6S2 — CID 138974233
2-pyridin-2-ylpyridine;triphenyl-bis(trifluoromethylsulfonyloxy)bismuth (PubChem CID 138974233) has the molecular formula C30H23BiF6N2O6S2 and a molecular weight of 894.62 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;triphenyl-bis(trifluoromethylsulfonyloxy)bismuth.
| Compound Name | 2-pyridin-2-ylpyridine;triphenyl-bis(trifluoromethylsulfonyloxy)bismuth |
|---|---|
| PubChem CID | 138974233 |
| Molecular Formula | C30H23BiF6N2O6S2 |
| Molecular Weight | 894.62 g/mol |
| Exact Mass | 894.07 |
| IUPAC Name | 2-pyridin-2-ylpyridine;triphenyl-bis(trifluoromethylsulfonyloxy)bismuth |
| SMILES | O=S(=O)(O[Bi](OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.3C6H5.2CHF3O3S.Bi/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-2-4-6-5-3-1;2*2-1(3,4)8(5,6)7;/h1-8H;3*1-5H;2*(H,5,6,7);/q;;;;;;+2/p-2 |
| InChIKey | GMAGKWXPDBUDCO-UHFFFAOYSA-L |
| XLogP | 4.98 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|