C34H35BiF6N4O6S2 — CID 138974231
bis(N,N-dimethylpyridin-4-amine);triphenyl-bis(trifluoromethylsulfonyloxy)bismuth (PubChem CID 138974231) has the molecular formula C34H35BiF6N4O6S2 and a molecular weight of 982.78 g/mol. Its IUPAC name is bis(N,N-dimethylpyridin-4-amine);triphenyl-bis(trifluoromethylsulfonyloxy)bismuth.
| Compound Name | bis(N,N-dimethylpyridin-4-amine);triphenyl-bis(trifluoromethylsulfonyloxy)bismuth |
|---|---|
| PubChem CID | 138974231 |
| Molecular Formula | C34H35BiF6N4O6S2 |
| Molecular Weight | 982.78 g/mol |
| Exact Mass | 982.17 |
| IUPAC Name | bis(N,N-dimethylpyridin-4-amine);triphenyl-bis(trifluoromethylsulfonyloxy)bismuth |
| SMILES | CN(C)c1ccncc1.CN(C)c1ccncc1.O=S(=O)(O[Bi](OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/2C7H10N2.3C6H5.2CHF3O3S.Bi/c2*1-9(2)7-3-5-8-6-4-7;3*1-2-4-6-5-3-1;2*2-1(3,4)8(5,6)7;/h2*3-6H,1-2H3;3*1-5H;2*(H,5,6,7);/q;;;;;;;+2/p-2 |
| InChIKey | HARXMRJADDDZAZ-UHFFFAOYSA-L |
| XLogP | 5.13 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|