C14H12O2S2 — CID 138975244
2-(3,4-dihydronaphthalen-2-ylsulfonyl)thiophene (PubChem CID 138975244) has the molecular formula C14H12O2S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(3,4-dihydronaphthalen-2-ylsulfonyl)thiophene.
| Compound Name | 2-(3,4-dihydronaphthalen-2-ylsulfonyl)thiophene |
|---|---|
| PubChem CID | 138975244 |
| Molecular Formula | C14H12O2S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-(3,4-dihydronaphthalen-2-ylsulfonyl)thiophene |
| SMILES | O=S(=O)(C1=Cc2ccccc2CC1)c1cccs1 |
| InChI | InChI=1S/C14H12O2S2/c15-18(16,14-6-3-9-17-14)13-8-7-11-4-1-2-5-12(11)10-13/h1-6,9-10H,7-8H2 |
| InChIKey | UNTMQNQKIUYVDS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |