C17H23NO4S — CID 39912433
methyl 6-(3,4-dihydronaphthalen-2-ylsulfonylamino)hexanoate (PubChem CID 39912433) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is methyl 6-(3,4-dihydronaphthalen-2-ylsulfonylamino)hexanoate.
| Compound Name | methyl 6-(3,4-dihydronaphthalen-2-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 39912433 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 6-(3,4-dihydronaphthalen-2-ylsulfonylamino)hexanoate |
| SMILES | COC(=O)CCCCCNS(=O)(=O)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C17H23NO4S/c1-22-17(19)9-3-2-6-12-18-23(20,21)16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,13,18H,2-3,6,9-12H2,1H3 |
| InChIKey | JGSKZPGJQDVNFC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|