C16H22N2O2S — CID 75412961
1-(3,4-dihydronaphthalen-2-ylsulfonyl)-4-methyl-1,4-diazepane (PubChem CID 75412961) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(3,4-dihydronaphthalen-2-ylsulfonyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(3,4-dihydronaphthalen-2-ylsulfonyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 75412961 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(3,4-dihydronaphthalen-2-ylsulfonyl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(S(=O)(=O)C2=Cc3ccccc3CC2)CC1 |
| InChI | InChI=1S/C16H22N2O2S/c1-17-9-4-10-18(12-11-17)21(19,20)16-8-7-14-5-2-3-6-15(14)13-16/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | LDLKWBOGNQSIKK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |