C25H20F3NO2 — CID 138975292
5,6-dimethoxy-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline (PubChem CID 138975292) has the molecular formula C25H20F3NO2 and a molecular weight of 423.43 g/mol. Its IUPAC name is 5,6-dimethoxy-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline.
| Compound Name | 5,6-dimethoxy-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline |
|---|---|
| PubChem CID | 138975292 |
| Molecular Formula | C25H20F3NO2 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5,6-dimethoxy-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline |
| SMILES | COc1ccc2c(CC(F)(F)F)nc(-c3ccccc3)c(-c3ccccc3)c2c1OC |
| InChI | InChI=1S/C25H20F3NO2/c1-30-20-14-13-18-19(15-25(26,27)28)29-23(17-11-7-4-8-12-17)21(22(18)24(20)31-2)16-9-5-3-6-10-16/h3-14H,15H2,1-2H3 |
| InChIKey | BOQCDRGTHHGMDA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |