C23H15BrF3N — CID 138975290
7-bromo-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline (PubChem CID 138975290) has the molecular formula C23H15BrF3N and a molecular weight of 442.28 g/mol. Its IUPAC name is 7-bromo-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline.
| Compound Name | 7-bromo-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline |
|---|---|
| PubChem CID | 138975290 |
| Molecular Formula | C23H15BrF3N |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 7-bromo-3,4-diphenyl-1-(2,2,2-trifluoroethyl)isoquinoline |
| SMILES | FC(F)(F)Cc1nc(-c2ccccc2)c(-c2ccccc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C23H15BrF3N/c24-17-11-12-18-19(13-17)20(14-23(25,26)27)28-22(16-9-5-2-6-10-16)21(18)15-7-3-1-4-8-15/h1-13H,14H2 |
| InChIKey | IYZOUNVSRJDFJL-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |