C15H15F3O6S — CID 138976298
(2,3,5-trimethoxy-7-methylnaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 138976298) has the molecular formula C15H15F3O6S and a molecular weight of 380.34 g/mol. Its IUPAC name is (2,3,5-trimethoxy-7-methylnaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (2,3,5-trimethoxy-7-methylnaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138976298 |
| Molecular Formula | C15H15F3O6S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (2,3,5-trimethoxy-7-methylnaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | COc1cc2c(OC)cc(C)cc2c(OS(=O)(=O)C(F)(F)F)c1OC |
| InChI | InChI=1S/C15H15F3O6S/c1-8-5-10-9(11(6-8)21-2)7-12(22-3)14(23-4)13(10)24-25(19,20)15(16,17)18/h5-7H,1-4H3 |
| InChIKey | NXEMIZKCBLQICO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|