About 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide
3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide (PubChem CID 138976312) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide |
| PubChem CID | 138976312 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide |
| SMILES | CC(C)(Cc1nc2ccccc2o1)C(=O)/N=c1/ccccn1O |
| InChI | InChI=1S/C17H17N3O3/c1-17(2,16(21)19-14-9-5-6-10-20(14)22)11-15-18-12-7-3-4-8-13(12)23-15/h3-10,22H,11H2,1-2H3/b19-14- |
| InChIKey | UOAOBZGBKHOVLS-RGEXLXHISA-N |
| XLogP | 2.56 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The IUPAC name of 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide (CID 138976312) is 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide.
What is the SMILES notation for 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The canonical SMILES for 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide is CC(C)(Cc1nc2ccccc2o1)C(=O)/N=c1/ccccn1O.
What is the InChIKey of 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The InChIKey is UOAOBZGBKHOVLS-RGEXLXHISA-N. The full InChI is InChI=1S/C17H17N3O3/c1-17(2,16(21)19-14-9-5-6-10-20(14)22)11-15-18-12-7-3-4-8-13(12)23-15/h3-10,22H,11H2,1-2H3/b19-14-.
What are the key properties of 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide has a molecular weight of 311.34 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzoxazol-2-yl)-N-(1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide is sourced from PubChem (CID 138976312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).