C13H11INO- — CID 138976908
(E)-(2-iodocyclopenta-2,4-dien-1-ylidene)-(N-methylanilino)methanolate (PubChem CID 138976908) has the molecular formula C13H11INO- and a molecular weight of 324.14 g/mol. Its IUPAC name is (E)-(2-iodocyclopenta-2,4-dien-1-ylidene)-(N-methylanilino)methanolate.
| Compound Name | (E)-(2-iodocyclopenta-2,4-dien-1-ylidene)-(N-methylanilino)methanolate |
|---|---|
| PubChem CID | 138976908 |
| Molecular Formula | C13H11INO- |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (E)-(2-iodocyclopenta-2,4-dien-1-ylidene)-(N-methylanilino)methanolate |
| SMILES | CN(/C([O-])=C1/C=CC=C1I)c1ccccc1 |
| InChI | InChI=1S/C13H12INO/c1-15(10-6-3-2-4-7-10)13(16)11-8-5-9-12(11)14/h2-9,16H,1H3/p-1/b13-11+ |
| InChIKey | GEPWKXYUUBXNRS-ACCUITESSA-M |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|