C12H14Cl3NO3 — CID 138976927
tert-butyl [2-methyl-6-(trichloromethyl)-4-pyridinyl] carbonate (PubChem CID 138976927) has the molecular formula C12H14Cl3NO3 and a molecular weight of 326.61 g/mol. Its IUPAC name is tert-butyl [2-methyl-6-(trichloromethyl)-4-pyridinyl] carbonate.
| Compound Name | tert-butyl [2-methyl-6-(trichloromethyl)-4-pyridinyl] carbonate |
|---|---|
| PubChem CID | 138976927 |
| Molecular Formula | C12H14Cl3NO3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | tert-butyl [2-methyl-6-(trichloromethyl)-4-pyridinyl] carbonate |
| SMILES | Cc1cc(OC(=O)OC(C)(C)C)cc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H14Cl3NO3/c1-7-5-8(6-9(16-7)12(13,14)15)18-10(17)19-11(2,3)4/h5-6H,1-4H3 |
| InChIKey | RLJDQIDUCLWQKL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|