C14H14N2O3S — CID 138976936
(3S)-3-methoxy-1-pyridin-2-ylsulfonyl-2,3-dihydroindole (PubChem CID 138976936) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (3S)-3-methoxy-1-pyridin-2-ylsulfonyl-2,3-dihydroindole.
| Compound Name | (3S)-3-methoxy-1-pyridin-2-ylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 138976936 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (3S)-3-methoxy-1-pyridin-2-ylsulfonyl-2,3-dihydroindole |
| SMILES | CO[C@@H]1CN(S(=O)(=O)c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C14H14N2O3S/c1-19-13-10-16(12-7-3-2-6-11(12)13)20(17,18)14-8-4-5-9-15-14/h2-9,13H,10H2,1H3/t13-/m1/s1 |
| InChIKey | NRFCBYUQIMGXIW-CYBMUJFWSA-N |
| XLogP | 1.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |