C19H16N2O2S — CID 102442471
3-phenyl-1-pyridin-2-ylsulfonyl-2,3-dihydroindole (PubChem CID 102442471) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 3-phenyl-1-pyridin-2-ylsulfonyl-2,3-dihydroindole.
| Compound Name | 3-phenyl-1-pyridin-2-ylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 102442471 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-phenyl-1-pyridin-2-ylsulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccccn1)N1CC(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H16N2O2S/c22-24(23,19-12-6-7-13-20-19)21-14-17(15-8-2-1-3-9-15)16-10-4-5-11-18(16)21/h1-13,17H,14H2 |
| InChIKey | ZVDGCHUIBWKKAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |