C23H26O4 — CID 138977590
tert-butyl (3aS,9S,9aR)-3a-hydroxy-9-phenyl-1,2,3,9-tetrahydrocyclopenta[b]chromene-9a-carboxylate (PubChem CID 138977590) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl (3aS,9S,9aR)-3a-hydroxy-9-phenyl-1,2,3,9-tetrahydrocyclopenta[b]chromene-9a-carboxylate.
| Compound Name | tert-butyl (3aS,9S,9aR)-3a-hydroxy-9-phenyl-1,2,3,9-tetrahydrocyclopenta[b]chromene-9a-carboxylate |
|---|---|
| PubChem CID | 138977590 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | tert-butyl (3aS,9S,9aR)-3a-hydroxy-9-phenyl-1,2,3,9-tetrahydrocyclopenta[b]chromene-9a-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12CCC[C@]1(O)Oc1ccccc1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C23H26O4/c1-21(2,3)27-20(24)22-14-9-15-23(22,25)26-18-13-8-7-12-17(18)19(22)16-10-5-4-6-11-16/h4-8,10-13,19,25H,9,14-15H2,1-3H3/t19-,22-,23-/m0/s1 |
| InChIKey | KBQNNONNABXFEH-VJBMBRPKSA-N |
| XLogP | 4.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |