C14H22BF3NO3- — CID 138977782
[3-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2,6-dihydropyridin-4-yl]-trifluoroboranuide (PubChem CID 138977782) has the molecular formula C14H22BF3NO3- and a molecular weight of 320.14 g/mol. Its IUPAC name is [3-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2,6-dihydropyridin-4-yl]-trifluoroboranuide.
| Compound Name | [3-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2,6-dihydropyridin-4-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 138977782 |
| Molecular Formula | C14H22BF3NO3- |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [3-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2,6-dihydropyridin-4-yl]-trifluoroboranuide |
| SMILES | CCCCC1=C([B-](F)(F)F)C(=O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H22BF3NO3/c1-5-6-7-10-8-19(13(21)22-14(2,3)4)9-11(20)12(10)15(16,17)18/h5-9H2,1-4H3/q-1 |
| InChIKey | XEYREAJQSOVLLH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|