C14H24O3 — CID 138977847
1-[(2S,4S,6S)-4-hydroxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]butan-2-one (PubChem CID 138977847) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 1-[(2S,4S,6S)-4-hydroxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]butan-2-one.
| Compound Name | 1-[(2S,4S,6S)-4-hydroxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 138977847 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-[(2S,4S,6S)-4-hydroxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]butan-2-one |
| SMILES | C=CC[C@@H]1O[C@H](CC(=O)CC)C[C@H](O)C1(C)C |
| InChI | InChI=1S/C14H24O3/c1-5-7-13-14(3,4)12(16)9-11(17-13)8-10(15)6-2/h5,11-13,16H,1,6-9H2,2-4H3/t11-,12+,13+/m1/s1 |
| InChIKey | QAJZTUBDUMKGKL-AGIUHOORSA-N |
| XLogP | 2.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|