C15H28O2 — CID 138978000
(E)-2,6-dimethyl-8-(oxan-2-yl)oct-7-en-2-ol (PubChem CID 138978000) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E)-2,6-dimethyl-8-(oxan-2-yl)oct-7-en-2-ol.
| Compound Name | (E)-2,6-dimethyl-8-(oxan-2-yl)oct-7-en-2-ol |
|---|---|
| PubChem CID | 138978000 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E)-2,6-dimethyl-8-(oxan-2-yl)oct-7-en-2-ol |
| SMILES | CC(/C=C/C1CCCCO1)CCCC(C)(C)O |
| InChI | InChI=1S/C15H28O2/c1-13(7-6-11-15(2,3)16)9-10-14-8-4-5-12-17-14/h9-10,13-14,16H,4-8,11-12H2,1-3H3/b10-9+ |
| InChIKey | ULJQRLMWRKPAHL-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|