C14H18O2 — CID 163034272
(E,3S)-9-[(2R)-oxan-2-yl]non-8-en-4,6-diyn-3-ol (PubChem CID 163034272) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (E,3S)-9-[(2R)-oxan-2-yl]non-8-en-4,6-diyn-3-ol.
| Compound Name | (E,3S)-9-[(2R)-oxan-2-yl]non-8-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 163034272 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E,3S)-9-[(2R)-oxan-2-yl]non-8-en-4,6-diyn-3-ol |
| SMILES | CC[C@H](O)C#CC#C/C=C/[C@H]1CCCCO1 |
| InChI | InChI=1S/C14H18O2/c1-2-13(15)9-5-3-4-6-10-14-11-7-8-12-16-14/h6,10,13-15H,2,7-8,11-12H2,1H3/b10-6+/t13-,14-/m0/s1 |
| InChIKey | UYLHCUVJHXMJIO-DXHQHAPDSA-N |
| XLogP | 1.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|