C14H16O2 — CID 101416718
(8E)-9-(oxan-2-yl)nona-1,8-dien-4,6-diyn-3-ol (PubChem CID 101416718) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (8E)-9-(oxan-2-yl)nona-1,8-dien-4,6-diyn-3-ol.
| Compound Name | (8E)-9-(oxan-2-yl)nona-1,8-dien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 101416718 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (8E)-9-(oxan-2-yl)nona-1,8-dien-4,6-diyn-3-ol |
| SMILES | C=CC(O)C#CC#C/C=C/C1CCCCO1 |
| InChI | InChI=1S/C14H16O2/c1-2-13(15)9-5-3-4-6-10-14-11-7-8-12-16-14/h2,6,10,13-15H,1,7-8,11-12H2/b10-6+ |
| InChIKey | MIVJWRRWBGYYDS-UXBLZVDNSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|