About 2-nona-1,7-dien-3,5-diynyloxan-3-ol
2-nona-1,7-dien-3,5-diynyloxan-3-ol (PubChem CID 551494) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-nona-1,7-dien-3,5-diynyloxan-3-ol.
Molecular Properties
| Compound Name | 2-nona-1,7-dien-3,5-diynyloxan-3-ol |
| PubChem CID | 551494 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-nona-1,7-dien-3,5-diynyloxan-3-ol |
| SMILES | CC=CC#CC#CC=CC1OCCCC1O |
| InChI | InChI=1S/C14H16O2/c1-2-3-4-5-6-7-8-11-14-13(15)10-9-12-16-14/h2-3,8,11,13-15H,9-10,12H2,1H3 |
| InChIKey | HAMPDEKVXLFKLK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nona-1,7-dien-3,5-diynyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nona-1,7-dien-3,5-diynyloxan-3-ol?
The IUPAC name of 2-nona-1,7-dien-3,5-diynyloxan-3-ol (CID 551494) is 2-nona-1,7-dien-3,5-diynyloxan-3-ol.
What is the SMILES notation for 2-nona-1,7-dien-3,5-diynyloxan-3-ol?
The canonical SMILES for 2-nona-1,7-dien-3,5-diynyloxan-3-ol is CC=CC#CC#CC=CC1OCCCC1O.
What is the InChIKey of 2-nona-1,7-dien-3,5-diynyloxan-3-ol?
The InChIKey is HAMPDEKVXLFKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-2-3-4-5-6-7-8-11-14-13(15)10-9-12-16-14/h2-3,8,11,13-15H,9-10,12H2,1H3.
What are the key properties of 2-nona-1,7-dien-3,5-diynyloxan-3-ol?
2-nona-1,7-dien-3,5-diynyloxan-3-ol has a molecular weight of 216.28 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nona-1,7-dien-3,5-diynyloxan-3-ol is sourced from PubChem (CID 551494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).