C31H32INO6S — CID 138978467
dimethyl 2-[[2-iodo-3-[(4-methylphenyl)sulfonylamino]phenyl]methyl]-2-[(5E)-6-phenylhexa-3,5-dienyl]propanedioate (PubChem CID 138978467) has the molecular formula C31H32INO6S and a molecular weight of 673.57 g/mol. Its IUPAC name is dimethyl 2-[[2-iodo-3-[(4-methylphenyl)sulfonylamino]phenyl]methyl]-2-[(5E)-6-phenylhexa-3,5-dienyl]propanedioate.
| Compound Name | dimethyl 2-[[2-iodo-3-[(4-methylphenyl)sulfonylamino]phenyl]methyl]-2-[(5E)-6-phenylhexa-3,5-dienyl]propanedioate |
|---|---|
| PubChem CID | 138978467 |
| Molecular Formula | C31H32INO6S |
| Molecular Weight | 673.57 g/mol |
| Exact Mass | 673.10 |
| IUPAC Name | dimethyl 2-[[2-iodo-3-[(4-methylphenyl)sulfonylamino]phenyl]methyl]-2-[(5E)-6-phenylhexa-3,5-dienyl]propanedioate |
| SMILES | COC(=O)C(CCC=C/C=C/c1ccccc1)(Cc1cccc(NS(=O)(=O)c2ccc(C)cc2)c1I)C(=O)OC |
| InChI | InChI=1S/C31H32INO6S/c1-23-17-19-26(20-18-23)40(36,37)33-27-16-11-15-25(28(27)32)22-31(29(34)38-2,30(35)39-3)21-10-5-4-7-12-24-13-8-6-9-14-24/h4-9,11-20,33H,10,21-22H2,1-3H3/b5-4?,12-7+ |
| InChIKey | FBVNOJXJEOEEQF-MXRWVBCXSA-N |
| XLogP | 6.33 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|