C20H23NO4 — CID 138979702
2-[(1S)-1-(2-adamantyl)-2,2-dihydroxyethyl]isoindole-1,3-dione (PubChem CID 138979702) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[(1S)-1-(2-adamantyl)-2,2-dihydroxyethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-(2-adamantyl)-2,2-dihydroxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138979702 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[(1S)-1-(2-adamantyl)-2,2-dihydroxyethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H](C(O)O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H23NO4/c22-18-14-3-1-2-4-15(14)19(23)21(18)17(20(24)25)16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16-17,20,24-25H,5-9H2/t10?,11?,12?,13?,16?,17-/m0/s1 |
| InChIKey | GAKBAHOGIURENV-KTEXAEBDSA-N |
| XLogP | 2.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|