C24H23NO — CID 138981125
(E,2R)-2-(4-methylanilino)-1,5-diphenylpent-4-en-1-one (PubChem CID 138981125) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is (E,2R)-2-(4-methylanilino)-1,5-diphenylpent-4-en-1-one.
| Compound Name | (E,2R)-2-(4-methylanilino)-1,5-diphenylpent-4-en-1-one |
|---|---|
| PubChem CID | 138981125 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (E,2R)-2-(4-methylanilino)-1,5-diphenylpent-4-en-1-one |
| SMILES | Cc1ccc(N[C@H](C/C=C/c2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO/c1-19-15-17-22(18-16-19)25-23(24(26)21-12-6-3-7-13-21)14-8-11-20-9-4-2-5-10-20/h2-13,15-18,23,25H,14H2,1H3/b11-8+/t23-/m1/s1 |
| InChIKey | OLALSJPZCGASRZ-OXHGWOFKSA-N |
| XLogP | 5.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |