C19H30O3 — CID 138981532
ethyl (1R,3R,3aR,7R,7aR)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylate (PubChem CID 138981532) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethyl (1R,3R,3aR,7R,7aR)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylate.
| Compound Name | ethyl (1R,3R,3aR,7R,7aR)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylate |
|---|---|
| PubChem CID | 138981532 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethyl (1R,3R,3aR,7R,7aR)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carboxylate |
| SMILES | C=C(C)C[C@H]1O[C@@H](C(=O)OCC)[C@H]2[C@@H]1C(=C)CC[C@@H]2C(C)C |
| InChI | InChI=1S/C19H30O3/c1-7-21-19(20)18-17-14(12(4)5)9-8-13(6)16(17)15(22-18)10-11(2)3/h12,14-18H,2,6-10H2,1,3-5H3/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | ARLAFNXISWZHIC-DUQPFJRNSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|