C22H13ClN2O3 — CID 138982502
3-[(5-chloro-2-pyridinyl)amino]-2-phenylfuro[3,2-c]chromen-4-one (PubChem CID 138982502) has the molecular formula C22H13ClN2O3 and a molecular weight of 388.81 g/mol. Its IUPAC name is 3-[(5-chloro-2-pyridinyl)amino]-2-phenylfuro[3,2-c]chromen-4-one.
| Compound Name | 3-[(5-chloro-2-pyridinyl)amino]-2-phenylfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 138982502 |
| Molecular Formula | C22H13ClN2O3 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-[(5-chloro-2-pyridinyl)amino]-2-phenylfuro[3,2-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2oc(-c3ccccc3)c(Nc3ccc(Cl)cn3)c12 |
| InChI | InChI=1S/C22H13ClN2O3/c23-14-10-11-17(24-12-14)25-19-18-21(28-20(19)13-6-2-1-3-7-13)15-8-4-5-9-16(15)27-22(18)26/h1-12H,(H,24,25) |
| InChIKey | WDZGCHFHRWAROE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|