C16H14O2S — CID 138983338
(4R,5S)-5-phenyl-4-phenylsulfanyloxolan-2-one (PubChem CID 138983338) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is (4R,5S)-5-phenyl-4-phenylsulfanyloxolan-2-one.
| Compound Name | (4R,5S)-5-phenyl-4-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 138983338 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (4R,5S)-5-phenyl-4-phenylsulfanyloxolan-2-one |
| SMILES | O=C1C[C@@H](Sc2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H14O2S/c17-15-11-14(19-13-9-5-2-6-10-13)16(18-15)12-7-3-1-4-8-12/h1-10,14,16H,11H2/t14-,16+/m1/s1 |
| InChIKey | IRMKWNSTFZHLMU-ZBFHGGJFSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |