C22H24O2 — CID 138983360
(2S,3R,4R)-2,3,4-trimethyl-7-methylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 138983360) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4-trimethyl-7-methylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (2S,3R,4R)-2,3,4-trimethyl-7-methylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 138983360 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2S,3R,4R)-2,3,4-trimethyl-7-methylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | C=C1OC2(c3ccccc3)OC1(c1ccccc1)[C@@H](C)[C@@H](C)[C@H]2C |
| InChI | InChI=1S/C22H24O2/c1-15-16(2)21(19-11-7-5-8-12-19)18(4)23-22(24-21,17(15)3)20-13-9-6-10-14-20/h5-17H,4H2,1-3H3/t15-,16+,17-,21?,22?/m1/s1 |
| InChIKey | QQZLNHIGIYWRLI-XYOLMSGHSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |