C28H38N2O12S — CID 138983859
[(2R)-2-[(4S,5S)-5-[(1R)-2-hydroxy-1-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)ethyl] methanesulfonate (PubChem CID 138983859) has the molecular formula C28H38N2O12S and a molecular weight of 626.68 g/mol. Its IUPAC name is [(2R)-2-[(4S,5S)-5-[(1R)-2-hydroxy-1-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)ethyl] methanesulfonate.
| Compound Name | [(2R)-2-[(4S,5S)-5-[(1R)-2-hydroxy-1-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 138983859 |
| Molecular Formula | C28H38N2O12S |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [(2R)-2-[(4S,5S)-5-[(1R)-2-hydroxy-1-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)ethyl] methanesulfonate |
| SMILES | COCO[C@H](COS(C)(=O)=O)[C@H]1OC(C)(C)O[C@H]1[C@@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H38N2O12S/c1-28(2)41-24(25(42-28)23(39-19-36-3)18-40-43(4,34)35)22(15-31)30(27(33)38-17-21-13-9-6-10-14-21)29-26(32)37-16-20-11-7-5-8-12-20/h5-14,22-25,31H,15-19H2,1-4H3,(H,29,32)/t22-,23-,24+,25-/m1/s1 |
| InChIKey | JEZRVBJQDTUVHF-ZKGSSEMHSA-N |
| XLogP | 2.31 |
| TPSA | 168.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|