C16H18O3S — CID 138984015
(1S,2S,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,4'-cyclohexene] (PubChem CID 138984015) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (1S,2S,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,4'-cyclohexene].
| Compound Name | (1S,2S,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,4'-cyclohexene] |
|---|---|
| PubChem CID | 138984015 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1S,2S,5R)-1-(benzenesulfonyl)spiro[3-oxabicyclo[3.1.0]hexane-2,4'-cyclohexene] |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12C[C@@H]1CO[C@@]21CC=CCC1 |
| InChI | InChI=1S/C16H18O3S/c17-20(18,14-7-3-1-4-8-14)16-11-13(16)12-19-15(16)9-5-2-6-10-15/h1-5,7-8,13H,6,9-12H2/t13-,15-,16+/m1/s1 |
| InChIKey | LQLIQRPAEUUVQA-BMFZPTHFSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|