C18H22O3S — CID 138984112
(1S,2S,5R)-1-(benzenesulfonyl)-2-but-3-enyl-2-prop-2-enyl-3-oxabicyclo[3.1.0]hexane (PubChem CID 138984112) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is (1S,2S,5R)-1-(benzenesulfonyl)-2-but-3-enyl-2-prop-2-enyl-3-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2S,5R)-1-(benzenesulfonyl)-2-but-3-enyl-2-prop-2-enyl-3-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 138984112 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (1S,2S,5R)-1-(benzenesulfonyl)-2-but-3-enyl-2-prop-2-enyl-3-oxabicyclo[3.1.0]hexane |
| SMILES | C=CCC[C@@]1(CC=C)OC[C@H]2C[C@]21S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O3S/c1-3-5-12-17(11-4-2)18(13-15(18)14-21-17)22(19,20)16-9-7-6-8-10-16/h3-4,6-10,15H,1-2,5,11-14H2/t15-,17-,18+/m1/s1 |
| InChIKey | AZYBIHRRTPFKOS-NXHRZFHOSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|