C15H18O4S — CID 138984111
(1S,2R,5R)-1-(benzenesulfonyl)-2-but-3-enyl-3-oxabicyclo[3.1.0]hexan-2-ol (PubChem CID 138984111) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is (1S,2R,5R)-1-(benzenesulfonyl)-2-but-3-enyl-3-oxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1S,2R,5R)-1-(benzenesulfonyl)-2-but-3-enyl-3-oxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 138984111 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (1S,2R,5R)-1-(benzenesulfonyl)-2-but-3-enyl-3-oxabicyclo[3.1.0]hexan-2-ol |
| SMILES | C=CCC[C@@]1(O)OC[C@H]2C[C@]21S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O4S/c1-2-3-9-15(16)14(10-12(14)11-19-15)20(17,18)13-7-5-4-6-8-13/h2,4-8,12,16H,1,3,9-11H2/t12-,14+,15-/m1/s1 |
| InChIKey | QXCIPSKZEMIFMQ-VHDGCEQUSA-N |
| XLogP | 1.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|