C19H35NO3Si — CID 138984374
(4S)-4-[(2R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]-4-hydroxybutanenitrile (PubChem CID 138984374) has the molecular formula C19H35NO3Si and a molecular weight of 353.58 g/mol. Its IUPAC name is (4S)-4-[(2R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]-4-hydroxybutanenitrile.
| Compound Name | (4S)-4-[(2R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]-4-hydroxybutanenitrile |
|---|---|
| PubChem CID | 138984374 |
| Molecular Formula | C19H35NO3Si |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (4S)-4-[(2R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]-4-hydroxybutanenitrile |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC=CC[C@H]([C@@H](O)CCC#N)O1 |
| InChI | InChI=1S/C19H35NO3Si/c1-7-16(23-24(5,6)19(2,3)4)18-13-9-8-12-17(22-18)15(21)11-10-14-20/h8-9,15-18,21H,7,10-13H2,1-6H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | QNFQIBQRKGXAEU-MLHJIOFPSA-N |
| XLogP | 4.56 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|