C24H44O3Si2 — CID 5212813
1-[3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-yn-1-ol (PubChem CID 5212813) has the molecular formula C24H44O3Si2 and a molecular weight of 436.79 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-yn-1-ol.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-yn-1-ol |
|---|---|
| PubChem CID | 5212813 |
| Molecular Formula | C24H44O3Si2 |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-yn-1-ol |
| SMILES | CCC1OC(C(O)CC=CC#C[Si](C)(C)C)CC=CCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si2/c1-10-21-23(27-29(8,9)24(2,3)4)18-14-13-17-22(26-21)20(25)16-12-11-15-19-28(5,6)7/h11-14,20-23,25H,10,16-18H2,1-9H3 |
| InChIKey | AEAYTIFDAAZKPN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|