C12H21BrO3 — CID 71514407
(1R)-1-[(2R,7S)-7-[(1R)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]propane-1,3-diol (PubChem CID 71514407) has the molecular formula C12H21BrO3 and a molecular weight of 293.20 g/mol. Its IUPAC name is (1R)-1-[(2R,7S)-7-[(1R)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]propane-1,3-diol.
| Compound Name | (1R)-1-[(2R,7S)-7-[(1R)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 71514407 |
| Molecular Formula | C12H21BrO3 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (1R)-1-[(2R,7S)-7-[(1R)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]propane-1,3-diol |
| SMILES | CC[C@@H](Br)[C@@H]1CC=CC[C@H]([C@H](O)CCO)O1 |
| InChI | InChI=1S/C12H21BrO3/c1-2-9(13)11-5-3-4-6-12(16-11)10(15)7-8-14/h3-4,9-12,14-15H,2,5-8H2,1H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | HUUQNJMLPVPVOU-WISYIIOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|