C19H22N4O2 — CID 138986863
3-(3-but-3-ynyldiazirin-3-yl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]propanamide (PubChem CID 138986863) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 138986863 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]propanamide |
| SMILES | C#CCCC1(CCC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)N=N1 |
| InChI | InChI=1S/C19H22N4O2/c1-2-3-9-19(22-23-19)10-8-18(25)21-15(13-24)11-14-12-20-17-7-5-4-6-16(14)17/h1,4-7,12,15,20,24H,3,8-11,13H2,(H,21,25)/t15-/m1/s1 |
| InChIKey | CTNWJUWKHGOYLK-OAHLLOKOSA-N |
| XLogP | 2.54 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|