C18H22N2O2 — CID 138989894
3-methyl-N-[2-oxo-1-[(E)-2-phenylethenyl]piperidin-3-yl]but-2-enamide (PubChem CID 138989894) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-methyl-N-[2-oxo-1-[(E)-2-phenylethenyl]piperidin-3-yl]but-2-enamide.
| Compound Name | 3-methyl-N-[2-oxo-1-[(E)-2-phenylethenyl]piperidin-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 138989894 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-methyl-N-[2-oxo-1-[(E)-2-phenylethenyl]piperidin-3-yl]but-2-enamide |
| SMILES | CC(C)=CC(=O)NC1CCCN(/C=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C18H22N2O2/c1-14(2)13-17(21)19-16-9-6-11-20(18(16)22)12-10-15-7-4-3-5-8-15/h3-5,7-8,10,12-13,16H,6,9,11H2,1-2H3,(H,19,21)/b12-10+ |
| InChIKey | TUILJXOIOFNOER-ZRDIBKRKSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|