C19H26N4O3 — CID 138990539
(14aR)-N-cyclopentyl-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide (PubChem CID 138990539) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (14aR)-N-cyclopentyl-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide.
| Compound Name | (14aR)-N-cyclopentyl-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
|---|---|
| PubChem CID | 138990539 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (14aR)-N-cyclopentyl-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
| SMILES | O=C1CN2CCN(C(=O)NC3CCCC3)C[C@@H]2COc2ccccc2N1 |
| InChI | InChI=1S/C19H26N4O3/c24-18-12-22-9-10-23(19(25)20-14-5-1-2-6-14)11-15(22)13-26-17-8-4-3-7-16(17)21-18/h3-4,7-8,14-15H,1-2,5-6,9-13H2,(H,20,25)(H,21,24)/t15-/m1/s1 |
| InChIKey | KOGVUIMXVXOVNA-OAHLLOKOSA-N |
| XLogP | 1.66 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |