C14H20N2O3 — CID 138995042
2-[1-[2-(furan-3-yl)acetyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 138995042) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[1-[2-(furan-3-yl)acetyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-[1-[2-(furan-3-yl)acetyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 138995042 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[1-[2-(furan-3-yl)acetyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1CCN(C(=O)Cc2ccoc2)CC1 |
| InChI | InChI=1S/C14H20N2O3/c1-15-13(17)8-11-2-5-16(6-3-11)14(18)9-12-4-7-19-10-12/h4,7,10-11H,2-3,5-6,8-9H2,1H3,(H,15,17) |
| InChIKey | LKDNDLPZRLACQP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |