C18H20F3N3O3S2 — CID 138999956
4-[methyl-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 138999956) has the molecular formula C18H20F3N3O3S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-[methyl-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[methyl-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 138999956 |
| Molecular Formula | C18H20F3N3O3S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 4-[methyl-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1nc2c(s1)C(N(C)S(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1)CCC2 |
| InChI | InChI=1S/C18H20F3N3O3S2/c1-11-23-14-4-3-5-15(16(14)28-11)24(2)29(26,27)13-8-6-12(7-9-13)17(25)22-10-18(19,20)21/h6-9,15H,3-5,10H2,1-2H3,(H,22,25) |
| InChIKey | BRIRSGLFDRPFGA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |