C16H20ClN3O4S — CID 139006653
methyl 4-chloro-2-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate (PubChem CID 139006653) has the molecular formula C16H20ClN3O4S and a molecular weight of 385.87 g/mol. Its IUPAC name is methyl 4-chloro-2-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-chloro-2-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 139006653 |
| Molecular Formula | C16H20ClN3O4S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methyl 4-chloro-2-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
| SMILES | CCCC(C)c1cc(NS(=O)(=O)c2cc(Cl)ccc2C(=O)OC)n[nH]1 |
| InChI | InChI=1S/C16H20ClN3O4S/c1-4-5-10(2)13-9-15(19-18-13)20-25(22,23)14-8-11(17)6-7-12(14)16(21)24-3/h6-10H,4-5H2,1-3H3,(H2,18,19,20) |
| InChIKey | FNHNIEQUOATSIU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |