C17H23N3O5S — CID 154799189
methyl 2-methoxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate (PubChem CID 154799189) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl 2-methoxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 154799189 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 2-methoxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
| SMILES | CCCC(C)c1cc(NS(=O)(=O)c2ccc(OC)c(C(=O)OC)c2)n[nH]1 |
| InChI | InChI=1S/C17H23N3O5S/c1-5-6-11(2)14-10-16(19-18-14)20-26(22,23)12-7-8-15(24-3)13(9-12)17(21)25-4/h7-11H,5-6H2,1-4H3,(H2,18,19,20) |
| InChIKey | ULPRWWWZTXSJBA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |