C16H21N3O5S — CID 71852019
methyl 2-hydroxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate (PubChem CID 71852019) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate.
| Compound Name | methyl 2-hydroxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 71852019 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 2-hydroxy-5-[(5-pentan-2-yl-1H-pyrazol-3-yl)sulfamoyl]benzoate |
| SMILES | CCCC(C)c1cc(NS(=O)(=O)c2ccc(O)c(C(=O)OC)c2)n[nH]1 |
| InChI | InChI=1S/C16H21N3O5S/c1-4-5-10(2)13-9-15(18-17-13)19-25(22,23)11-6-7-14(20)12(8-11)16(21)24-3/h6-10,20H,4-5H2,1-3H3,(H2,17,18,19) |
| InChIKey | YYCXEQAFGXLOSI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |